C13H12ClNO2S — CID 126754935
4-(5-chloro-2-methylphenyl)benzenesulfonamide (PubChem CID 126754935) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)benzenesulfonamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126754935 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H12ClNO2S/c1-9-2-5-11(14)8-13(9)10-3-6-12(7-4-10)18(15,16)17/h2-8H,1H3,(H2,15,16,17) |
| InChIKey | USSDNQHZXHUBOD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |