C21H18N4O2S — CID 166490711
4-methyl-3-[4-(5-pyridin-4-yl-1H-pyrazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 166490711) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-methyl-3-[4-(5-pyridin-4-yl-1H-pyrazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-3-[4-(5-pyridin-4-yl-1H-pyrazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166490711 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-methyl-3-[4-(5-pyridin-4-yl-1H-pyrazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1-c1ccc(-c2cn[nH]c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-14-2-7-18(28(22,26)27)12-19(14)15-3-5-16(6-4-15)20-13-24-25-21(20)17-8-10-23-11-9-17/h2-13H,1H3,(H,24,25)(H2,22,26,27) |
| InChIKey | UTZZUELNWARHHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |