C14H8ClN5S — CID 107809028
3-chloro-4-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzonitrile (PubChem CID 107809028) has the molecular formula C14H8ClN5S and a molecular weight of 313.77 g/mol. Its IUPAC name is 3-chloro-4-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzonitrile.
| Compound Name | 3-chloro-4-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 107809028 |
| Molecular Formula | C14H8ClN5S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-chloro-4-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c(-c3ccncc3)n[nH]c2=S)c(Cl)c1 |
| InChI | InChI=1S/C14H8ClN5S/c15-11-7-9(8-16)1-2-12(11)20-13(18-19-14(20)21)10-3-5-17-6-4-10/h1-7H,(H,19,21) |
| InChIKey | KVWCSGUEDSPEMN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|