C13H8ClIN4S — CID 107607141
4-(2-chloro-4-iodophenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 107607141) has the molecular formula C13H8ClIN4S and a molecular weight of 414.66 g/mol. Its IUPAC name is 4-(2-chloro-4-iodophenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-chloro-4-iodophenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 107607141 |
| Molecular Formula | C13H8ClIN4S |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 4-(2-chloro-4-iodophenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccncc2)n1-c1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H8ClIN4S/c14-10-7-9(15)1-2-11(10)19-12(17-18-13(19)20)8-3-5-16-6-4-8/h1-7H,(H,18,20) |
| InChIKey | SYJJGKVESINQPA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|