About 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile
3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile (PubChem CID 107809056) has the molecular formula C14H6ClF2N3S
and a molecular weight of 321.74 g/mol. Its IUPAC name is 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile |
| PubChem CID | 107809056 |
| Molecular Formula | C14H6ClF2N3S |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c(=S)[nH]c3ccc(F)c(F)c32)c(Cl)c1 |
| InChI | InChI=1S/C14H6ClF2N3S/c15-8-5-7(6-18)1-4-11(8)20-13-10(19-14(20)21)3-2-9(16)12(13)17/h1-5H,(H,19,21) |
| InChIKey | HODBFSYDWPFPLL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile?
The IUPAC name of 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile (CID 107809056) is 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile.
What is the SMILES notation for 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile?
The canonical SMILES for 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile is N#Cc1ccc(-n2c(=S)[nH]c3ccc(F)c(F)c32)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile?
The InChIKey is HODBFSYDWPFPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6ClF2N3S/c15-8-5-7(6-18)1-4-11(8)20-13-10(19-14(20)21)3-2-9(16)12(13)17/h1-5H,(H,19,21).
What are the key properties of 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile?
3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile has a molecular weight of 321.74 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)benzonitrile is sourced from PubChem (CID 107809056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).