C15H9F2N3S — CID 107799531
2-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-6-methylbenzonitrile (PubChem CID 107799531) has the molecular formula C15H9F2N3S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-6-methylbenzonitrile.
| Compound Name | 2-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107799531 |
| Molecular Formula | C15H9F2N3S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(6,7-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-6-methylbenzonitrile |
| SMILES | Cc1cccc(-n2c(=S)[nH]c3ccc(F)c(F)c32)c1C#N |
| InChI | InChI=1S/C15H9F2N3S/c1-8-3-2-4-12(9(8)7-18)20-14-11(19-15(20)21)6-5-10(16)13(14)17/h2-6H,1H3,(H,19,21) |
| InChIKey | KHHNMDSHZVRGBA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|