C13H6Br2F2N2S — CID 107601231
3-(2,6-dibromophenyl)-4,5-difluoro-1H-benzimidazole-2-thione (PubChem CID 107601231) has the molecular formula C13H6Br2F2N2S and a molecular weight of 420.08 g/mol. Its IUPAC name is 3-(2,6-dibromophenyl)-4,5-difluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,6-dibromophenyl)-4,5-difluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107601231 |
| Molecular Formula | C13H6Br2F2N2S |
| Molecular Weight | 420.08 g/mol |
| Exact Mass | 417.86 |
| IUPAC Name | 3-(2,6-dibromophenyl)-4,5-difluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc2[nH]c(=S)n(-c3c(Br)cccc3Br)c2c1F |
| InChI | InChI=1S/C13H6Br2F2N2S/c14-6-2-1-3-7(15)11(6)19-12-9(18-13(19)20)5-4-8(16)10(12)17/h1-5H,(H,18,20) |
| InChIKey | NJLWULIAMOSAPH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.08 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|