C14H6F3N3S — CID 104714454
2-sulfanylidene-3-(2,3,5-trifluorophenyl)-1H-benzimidazole-5-carbonitrile (PubChem CID 104714454) has the molecular formula C14H6F3N3S and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-sulfanylidene-3-(2,3,5-trifluorophenyl)-1H-benzimidazole-5-carbonitrile.
| Compound Name | 2-sulfanylidene-3-(2,3,5-trifluorophenyl)-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714454 |
| Molecular Formula | C14H6F3N3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-sulfanylidene-3-(2,3,5-trifluorophenyl)-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=S)n(-c3cc(F)cc(F)c3F)c2c1 |
| InChI | InChI=1S/C14H6F3N3S/c15-8-4-9(16)13(17)12(5-8)20-11-3-7(6-18)1-2-10(11)19-14(20)21/h1-5H,(H,19,21) |
| InChIKey | SAFRCTXJSLRYKM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|