C14H7F2N3S — CID 104714240
3-(3,5-difluorophenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile (PubChem CID 104714240) has the molecular formula C14H7F2N3S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile.
| Compound Name | 3-(3,5-difluorophenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714240 |
| Molecular Formula | C14H7F2N3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=S)n(-c3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C14H7F2N3S/c15-9-4-10(16)6-11(5-9)19-13-3-8(7-17)1-2-12(13)18-14(19)20/h1-6H,(H,18,20) |
| InChIKey | TZFSQWDPNQSGPK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|