C10H10N4S — CID 104714615
3-(dimethylamino)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile (PubChem CID 104714615) has the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(dimethylamino)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile.
| Compound Name | 3-(dimethylamino)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714615 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(dimethylamino)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
| SMILES | CN(C)n1c(=S)[nH]c2ccc(C#N)cc21 |
| InChI | InChI=1S/C10H10N4S/c1-13(2)14-9-5-7(6-11)3-4-8(9)12-10(14)15/h3-5H,1-2H3,(H,12,15) |
| InChIKey | UKOYSMDMORCMOK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|