C16H12BrN3S — CID 104714589
3-(2-bromo-4,6-dimethylphenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile (PubChem CID 104714589) has the molecular formula C16H12BrN3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 3-(2-bromo-4,6-dimethylphenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile.
| Compound Name | 3-(2-bromo-4,6-dimethylphenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714589 |
| Molecular Formula | C16H12BrN3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 3-(2-bromo-4,6-dimethylphenyl)-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
| SMILES | Cc1cc(C)c(-n2c(=S)[nH]c3ccc(C#N)cc32)c(Br)c1 |
| InChI | InChI=1S/C16H12BrN3S/c1-9-5-10(2)15(12(17)6-9)20-14-7-11(8-18)3-4-13(14)19-16(20)21/h3-7H,1-2H3,(H,19,21) |
| InChIKey | BYQJWOGQHRCDEX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|