C27H30Cl2IN5O — CID 87445575
N-[3-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-4-ium-7-yl]acetamide iodide (PubChem CID 87445575) has the molecular formula C27H30Cl2IN5O and a molecular weight of 638.38 g/mol. Its IUPAC name is N-[3-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-4-ium-7-yl]acetamide iodide.
| Compound Name | N-[3-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-4-ium-7-yl]acetamide iodide |
|---|---|
| PubChem CID | 87445575 |
| Molecular Formula | C27H30Cl2IN5O |
| Molecular Weight | 638.38 g/mol |
| Exact Mass | 637.09 |
| IUPAC Name | N-[3-[2-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)ethylidene]-4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-4-ium-7-yl]acetamide iodide |
| SMILES | CCN1C(=CC=C2CCn3c2[n+](CC)c2ccc(NC(C)=O)cc23)N(CC)c2cc(Cl)c(Cl)cc21.[I-] |
| InChI | InChI=1S/C27H29Cl2N5O.HI/c1-5-31-24-15-20(28)21(29)16-25(24)32(6-2)26(31)11-8-18-12-13-34-23-14-19(30-17(4)35)9-10-22(23)33(7-3)27(18)34;/h8-11,14-16H,5-7,12-13H2,1-4H3;1H |
| InChIKey | LZAUBUSFNMAOLO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|