C25H27Cl2N3O4S — CID 71401346
4-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate (PubChem CID 71401346) has the molecular formula C25H27Cl2N3O4S and a molecular weight of 536.48 g/mol. Its IUPAC name is 4-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 71401346 |
| Molecular Formula | C25H27Cl2N3O4S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 4-[5,6-dichloro-3-ethyl-2-[3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate |
| SMILES | CCN1C(=CC=Cc2oc3ccccc3[n+]2CC)N(CCCCS(=O)(=O)[O-])c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C25H27Cl2N3O4S/c1-3-28-21-16-18(26)19(27)17-22(21)30(14-7-8-15-35(31,32)33)24(28)12-9-13-25-29(4-2)20-10-5-6-11-23(20)34-25/h5-6,9-13,16-17H,3-4,7-8,14-15H2,1-2H3 |
| InChIKey | ZGMJSLOKTMOPIY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 80.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|