C24H26Cl3N3O7S2 — CID 20615511
3-[5-chloro-2-[(E)-[5,6-dichloro-1-ethyl-3-(4-sulfobutyl)benzimidazol-2-ylidene]methyl]-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 20615511) has the molecular formula C24H26Cl3N3O7S2 and a molecular weight of 638.98 g/mol. Its IUPAC name is 3-[5-chloro-2-[(E)-[5,6-dichloro-1-ethyl-3-(4-sulfobutyl)benzimidazol-2-ylidene]methyl]-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[(E)-[5,6-dichloro-1-ethyl-3-(4-sulfobutyl)benzimidazol-2-ylidene]methyl]-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20615511 |
| Molecular Formula | C24H26Cl3N3O7S2 |
| Molecular Weight | 638.98 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | 3-[5-chloro-2-[(E)-[5,6-dichloro-1-ethyl-3-(4-sulfobutyl)benzimidazol-2-ylidene]methyl]-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CCN1/C(=C\c2oc3ccc(Cl)cc3[n+]2CCCS(=O)(=O)[O-])N(CCCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C24H26Cl3N3O7S2/c1-2-28-19-13-17(26)18(27)14-20(19)29(8-3-4-10-38(31,32)33)23(28)15-24-30(9-5-11-39(34,35)36)21-12-16(25)6-7-22(21)37-24/h6-7,12-15H,2-5,8-11H2,1H3,(H-,31,32,33,34,35,36) |
| InChIKey | HGZMMAXMOZDXEI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|