C29H30Cl2N3O7S2+ — CID 20726511
3-[2-[(E)-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-6-phenyl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 20726511) has the molecular formula C29H30Cl2N3O7S2+ and a molecular weight of 667.61 g/mol. Its IUPAC name is 3-[2-[(E)-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-6-phenyl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-6-phenyl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20726511 |
| Molecular Formula | C29H30Cl2N3O7S2+ |
| Molecular Weight | 667.61 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | 3-[2-[(E)-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-6-phenyl-1,3-benzoxazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C\c2oc3cc(-c4ccccc4)ccc3[n+]2CCCS(=O)(=O)O)N(CCCSOOO)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C29H29Cl2N3O7S2/c1-2-32-25-17-22(30)23(31)18-26(25)33(12-6-14-42-41-40-35)28(32)19-29-34(13-7-15-43(36,37)38)24-11-10-21(16-27(24)39-29)20-8-4-3-5-9-20/h3-5,8-11,16-19H,2,6-7,12-15H2,1H3,(H-,35,36,37,38)/p+1 |
| InChIKey | MLHDBAFOTRTUNO-UHFFFAOYSA-O |
| XLogP | 7.08 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|