C29H30ClN2O8S3+ — CID 20600298
3-[(2Z)-5-chloro-2-[(2E)-2-[[5-thiophen-2-yl-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 20600298) has the molecular formula C29H30ClN2O8S3+ and a molecular weight of 666.22 g/mol. Its IUPAC name is 3-[(2Z)-5-chloro-2-[(2E)-2-[[5-thiophen-2-yl-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-5-chloro-2-[(2E)-2-[[5-thiophen-2-yl-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20600298 |
| Molecular Formula | C29H30ClN2O8S3+ |
| Molecular Weight | 666.22 g/mol |
| Exact Mass | 665.08 |
| IUPAC Name | 3-[(2Z)-5-chloro-2-[(2E)-2-[[5-thiophen-2-yl-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCC(/C=C1\Oc2ccc(Cl)cc2N1CCCS(=O)(=O)O)=C\c1oc2ccc(-c3cccs3)cc2[n+]1CCCSOOO |
| InChI | InChI=1S/C29H29ClN2O8S3/c1-2-20(17-29-32(12-5-15-43(34,35)36)24-19-22(30)8-10-26(24)38-29)16-28-31(11-4-14-42-40-39-33)23-18-21(7-9-25(23)37-28)27-6-3-13-41-27/h3,6-10,13,16-19H,2,4-5,11-12,14-15H2,1H3,(H-,33,34,35,36)/p+1 |
| InChIKey | FYCIYVGOLCLMQB-UHFFFAOYSA-O |
| XLogP | 7.37 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.22 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|