C27H25ClN2O7S3 — CID 58696750
3-[2-[[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 58696750) has the molecular formula C27H25ClN2O7S3 and a molecular weight of 621.16 g/mol. Its IUPAC name is 3-[2-[[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58696750 |
| Molecular Formula | C27H25ClN2O7S3 |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 3-[2-[[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2CCCSOOO)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C27H25ClN2O7S3/c28-21-9-11-25-23(17-21)30(12-4-14-38-37-36-31)27(39-25)18-26-29(13-5-15-40(32,33)34)22-16-20(8-10-24(22)35-26)19-6-2-1-3-7-19/h1-3,6-11,16-18H,4-5,12-15H2,(H-,31,32,33,34) |
| InChIKey | WJGVAHRSPJVUON-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|