C26H22ClN2O7S3- — CID 59731264
3-[5-chloro-2-[[5-phenyl-3-(2-sulfinatooxyethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propyl sulfite (PubChem CID 59731264) has the molecular formula C26H22ClN2O7S3- and a molecular weight of 606.12 g/mol. Its IUPAC name is 3-[5-chloro-2-[[5-phenyl-3-(2-sulfinatooxyethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propyl sulfite.
| Compound Name | 3-[5-chloro-2-[[5-phenyl-3-(2-sulfinatooxyethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propyl sulfite |
|---|---|
| PubChem CID | 59731264 |
| Molecular Formula | C26H22ClN2O7S3- |
| Molecular Weight | 606.12 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | 3-[5-chloro-2-[[5-phenyl-3-(2-sulfinatooxyethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propyl sulfite |
| SMILES | O=S([O-])OCCC[n+]1c(C=C2Oc3ccc(-c4ccccc4)cc3N2CCOS(=O)[O-])sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H23ClN2O7S3/c27-20-8-10-24-22(16-20)29(11-4-13-34-38(30)31)26(37-24)17-25-28(12-14-35-39(32)33)21-15-19(7-9-23(21)36-25)18-5-2-1-3-6-18/h1-3,5-10,15-17H,4,11-14H2,(H-,30,31,32,33)/p-1 |
| InChIKey | KIMVELZKWOOIIS-UHFFFAOYSA-M |
| XLogP | 4.72 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.12 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|