C24H20ClN2O4S2+ — CID 59974350
2-[5-chloro-2-[(Z)-(3-methyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid (PubChem CID 59974350) has the molecular formula C24H20ClN2O4S2+ and a molecular weight of 500.02 g/mol. Its IUPAC name is 2-[5-chloro-2-[(Z)-(3-methyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid.
| Compound Name | 2-[5-chloro-2-[(Z)-(3-methyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 59974350 |
| Molecular Formula | C24H20ClN2O4S2+ |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 2-[5-chloro-2-[(Z)-(3-methyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid |
| SMILES | CN1/C(=C/c2sc3ccc(Cl)cc3[n+]2CCS(=O)(=O)O)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C24H19ClN2O4S2/c1-26-19-13-17(16-5-3-2-4-6-16)7-9-21(19)31-23(26)15-24-27(11-12-33(28,29)30)20-14-18(25)8-10-22(20)32-24/h2-10,13-15H,11-12H2,1H3/p+1 |
| InChIKey | PRIPTBIZNBKDOF-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|