C28H28ClN2O5S+ — CID 59120202
2-[2-[2-[(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)methyl]butyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid (PubChem CID 59120202) has the molecular formula C28H28ClN2O5S+ and a molecular weight of 540.06 g/mol. Its IUPAC name is 2-[2-[2-[(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)methyl]butyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid.
| Compound Name | 2-[2-[2-[(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)methyl]butyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 59120202 |
| Molecular Formula | C28H28ClN2O5S+ |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 2-[2-[2-[(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)methyl]butyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid |
| SMILES | CCC(C=C1Oc2ccc(Cl)cc2N1C)Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCS(=O)(=O)O |
| InChI | InChI=1S/C28H27ClN2O5S/c1-3-19(15-27-30(2)23-18-22(29)10-12-25(23)35-27)16-28-31(13-14-37(32,33)34)24-17-21(9-11-26(24)36-28)20-7-5-4-6-8-20/h4-12,15,17-19H,3,13-14,16H2,1-2H3/p+1 |
| InChIKey | NHGGWZKYTCXFGM-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|