C26H23ClN2O7S3 — CID 58713864
3-[5-chloro-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 58713864) has the molecular formula C26H23ClN2O7S3 and a molecular weight of 607.13 g/mol. Its IUPAC name is 3-[5-chloro-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58713864 |
| Molecular Formula | C26H23ClN2O7S3 |
| Molecular Weight | 607.13 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 3-[5-chloro-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1c(/C=C2\Oc3ccc(-c4ccccc4)cc3N2CCS(=O)(=O)O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H23ClN2O7S3/c27-20-8-10-24-22(16-20)29(11-4-13-38(30,31)32)26(37-24)17-25-28(12-14-39(33,34)35)21-15-19(7-9-23(21)36-25)18-5-2-1-3-6-18/h1-3,5-10,15-17H,4,11-14H2,(H-,30,31,32,33,34,35) |
| InChIKey | BKHHTOYNGBEFJD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.13 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|