C27H24ClN2O7S3- — CID 58587405
3-[5-chloro-2-[[5-phenyl-3-(3-sulfinatooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 58587405) has the molecular formula C27H24ClN2O7S3- and a molecular weight of 620.15 g/mol. Its IUPAC name is 3-[5-chloro-2-[[5-phenyl-3-(3-sulfinatooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[[5-phenyl-3-(3-sulfinatooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58587405 |
| Molecular Formula | C27H24ClN2O7S3- |
| Molecular Weight | 620.15 g/mol |
| Exact Mass | 619.04 |
| IUPAC Name | 3-[5-chloro-2-[[5-phenyl-3-(3-sulfinatooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S([O-])OCCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2CCCS(=O)(=O)[O-])Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C27H25ClN2O7S3/c28-21-9-11-25-23(17-21)30(13-5-15-40(33,34)35)27(38-25)18-26-29(12-4-14-36-39(31)32)22-16-20(8-10-24(22)37-26)19-6-2-1-3-7-19/h1-3,6-11,16-18H,4-5,12-15H2,(H-,31,32,33,34,35)/p-1 |
| InChIKey | AVHXDBDCQOYHNQ-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 122.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.15 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|