C36H33N3O4S2 — CID 20648368
3-[(2Z)-2-[(3-butyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-indol-1-yl-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 20648368) has the molecular formula C36H33N3O4S2 and a molecular weight of 635.81 g/mol. Its IUPAC name is 3-[(2Z)-2-[(3-butyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-indol-1-yl-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2Z)-2-[(3-butyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-indol-1-yl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20648368 |
| Molecular Formula | C36H33N3O4S2 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 3-[(2Z)-2-[(3-butyl-5-phenyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-indol-1-yl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | CCCC[n+]1c(/C=C2\Oc3ccc(-n4ccc5ccccc54)cc3N2CCCS(=O)(=O)[O-])sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C36H33N3O4S2/c1-2-3-19-39-32-23-28(26-10-5-4-6-11-26)14-17-34(32)44-36(39)25-35-38(20-9-22-45(40,41)42)31-24-29(15-16-33(31)43-35)37-21-18-27-12-7-8-13-30(27)37/h4-8,10-18,21,23-25H,2-3,9,19-20,22H2,1H3 |
| InChIKey | JTZAHEYECRBZDH-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|