C28H28Cl2N3O7S2+ — CID 74064920
2-[2-[[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid (PubChem CID 74064920) has the molecular formula C28H28Cl2N3O7S2+ and a molecular weight of 653.59 g/mol. Its IUPAC name is 2-[2-[[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid.
| Compound Name | 2-[2-[[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 74064920 |
| Molecular Formula | C28H28Cl2N3O7S2+ |
| Molecular Weight | 653.59 g/mol |
| Exact Mass | 652.07 |
| IUPAC Name | 2-[2-[[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)propyl]benzimidazol-2-ylidene]methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]ethanesulfonic acid |
| SMILES | CCN1C(=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CCS(=O)(=O)O)N(CCCSOOO)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C28H27Cl2N3O7S2/c1-2-31-23-16-21(29)22(30)17-24(23)32(11-6-13-41-40-39-34)27(31)18-28-33(12-14-42(35,36)37)25-15-20(9-10-26(25)38-28)19-7-4-3-5-8-19/h3-5,7-10,15-18H,2,6,11-14H2,1H3,(H-,34,35,36,37)/p+1 |
| InChIKey | KFXVCGLIEBTTNS-UHFFFAOYSA-O |
| XLogP | 6.69 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|