C35H34Cl2N3O5S+ — CID 74935469
2-[5,6-dichloro-2-[3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-methylbenzimidazol-1-yl]ethanol;4-methylbenzenesulfonic acid (PubChem CID 74935469) has the molecular formula C35H34Cl2N3O5S+ and a molecular weight of 679.65 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-[3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-methylbenzimidazol-1-yl]ethanol;4-methylbenzenesulfonic acid.
| Compound Name | 2-[5,6-dichloro-2-[3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-methylbenzimidazol-1-yl]ethanol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 74935469 |
| Molecular Formula | C35H34Cl2N3O5S+ |
| Molecular Weight | 679.65 g/mol |
| Exact Mass | 678.16 |
| IUPAC Name | 2-[5,6-dichloro-2-[3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-methylbenzimidazol-1-yl]ethanol;4-methylbenzenesulfonic acid |
| SMILES | CC[n+]1c(C=CC=C2N(C)c3cc(Cl)c(Cl)cc3N2CCO)oc2ccc(-c3ccccc3)cc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H26Cl2N3O2.C7H8O3S/c1-3-32-25-16-20(19-8-5-4-6-9-19)12-13-26(25)35-28(32)11-7-10-27-31(2)23-17-21(29)22(30)18-24(23)33(27)14-15-34;1-6-2-4-7(5-3-6)11(8,9)10/h4-13,16-18,34H,3,14-15H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | VQBUXFUINJEYEI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|