C55H53BN2O2 — CID 11093974
butyl(triphenyl)boranuide;(2Z)-3-ethyl-2-[(E)-3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazole (PubChem CID 11093974) has the molecular formula C55H53BN2O2 and a molecular weight of 784.85 g/mol. Its IUPAC name is butyl(triphenyl)boranuide;(2Z)-3-ethyl-2-[(E)-3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazole.
| Compound Name | butyl(triphenyl)boranuide;(2Z)-3-ethyl-2-[(E)-3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 11093974 |
| Molecular Formula | C55H53BN2O2 |
| Molecular Weight | 784.85 g/mol |
| Exact Mass | 784.42 |
| IUPAC Name | butyl(triphenyl)boranuide;(2Z)-3-ethyl-2-[(E)-3-(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazole |
| SMILES | CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.CCN1/C(=C/C=C/c2oc3ccc(-c4ccccc4)cc3[n+]2CC)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C33H29N2O2.C22H24B/c1-3-34-28-22-26(24-12-7-5-8-13-24)18-20-30(28)36-32(34)16-11-17-33-35(4-2)29-23-27(19-21-31(29)37-33)25-14-9-6-10-15-25;1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h5-23H,3-4H2,1-2H3;4-18H,2-3,19H2,1H3/q+1;-1 |
| InChIKey | CJAZVCZMSITOEB-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.85 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|