C23H21Cl2IN2O2 — CID 162305063
5-chloro-2-[5-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzoxazole iodide (PubChem CID 162305063) has the molecular formula C23H21Cl2IN2O2 and a molecular weight of 555.24 g/mol. Its IUPAC name is 5-chloro-2-[5-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzoxazole iodide.
| Compound Name | 5-chloro-2-[5-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzoxazole iodide |
|---|---|
| PubChem CID | 162305063 |
| Molecular Formula | C23H21Cl2IN2O2 |
| Molecular Weight | 555.24 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | 5-chloro-2-[5-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzoxazole iodide |
| SMILES | CCN1C(=CC=CC=Cc2oc3ccc(Cl)cc3[n+]2CC)Oc2ccc(Cl)cc21.[I-] |
| InChI | InChI=1S/C23H21Cl2N2O2.HI/c1-3-26-18-14-16(24)10-12-20(18)28-22(26)8-6-5-7-9-23-27(4-2)19-15-17(25)11-13-21(19)29-23;/h5-15H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BQEBKSWXHPNHOJ-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|