C23H25IN2O4 — CID 138401991
(2E)-3-ethyl-2-[(E)-3-(3-ethyl-6-methoxy-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzoxazole iodide (PubChem CID 138401991) has the molecular formula C23H25IN2O4 and a molecular weight of 520.37 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[(E)-3-(3-ethyl-6-methoxy-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzoxazole iodide.
| Compound Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-6-methoxy-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzoxazole iodide |
|---|---|
| PubChem CID | 138401991 |
| Molecular Formula | C23H25IN2O4 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-6-methoxy-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzoxazole iodide |
| SMILES | CCN1/C(=C\C=C\c2oc3cc(OC)ccc3[n+]2CC)Oc2cc(OC)ccc21.[I-] |
| InChI | InChI=1S/C23H25N2O4.HI/c1-5-24-18-12-10-16(26-3)14-20(18)28-22(24)8-7-9-23-25(6-2)19-13-11-17(27-4)15-21(19)29-23;/h7-15H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MFIGXPXHSLIGLF-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 47.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|