C21H27N2OS+ — CID 72652237
3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5,6-dimethyl-1,3-benzoxazole (PubChem CID 72652237) has the molecular formula C21H27N2OS+ and a molecular weight of 355.53 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5,6-dimethyl-1,3-benzoxazole.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5,6-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 72652237 |
| Molecular Formula | C21H27N2OS+ |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5,6-dimethyl-1,3-benzoxazole |
| SMILES | CCN1C(=CC=Cc2sc(C)c(C)[n+]2CC)Oc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H27N2OS/c1-7-22-16(5)17(6)25-21(22)11-9-10-20-23(8-2)18-12-14(3)15(4)13-19(18)24-20/h9-13H,7-8H2,1-6H3/q+1 |
| InChIKey | YFAZEPZVBPLYOB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|