C19H22N3O2S2+ — CID 161159960
3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5-nitro-1,3-benzothiazole (PubChem CID 161159960) has the molecular formula C19H22N3O2S2+ and a molecular weight of 388.54 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5-nitro-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 161159960 |
| Molecular Formula | C19H22N3O2S2+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-4,5-dimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]-5-nitro-1,3-benzothiazole |
| SMILES | CCN1C(=CC=Cc2sc(C)c(C)[n+]2CC)Sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H22N3O2S2/c1-5-20-13(3)14(4)25-18(20)8-7-9-19-21(6-2)16-12-15(22(23)24)10-11-17(16)26-19/h7-12H,5-6H2,1-4H3/q+1 |
| InChIKey | BRXYPTHPLMYGDH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|