C21H20ClN4O4S2- — CID 57371048
3-ethyl-2-[3-(3-ethyl-6-nitro-2H-1,3-benzothiazol-2-yl)prop-2-enylidene]-6-nitro-1,3-benzothiazole chloride (PubChem CID 57371048) has the molecular formula C21H20ClN4O4S2- and a molecular weight of 492.00 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-6-nitro-2H-1,3-benzothiazol-2-yl)prop-2-enylidene]-6-nitro-1,3-benzothiazole chloride.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-6-nitro-2H-1,3-benzothiazol-2-yl)prop-2-enylidene]-6-nitro-1,3-benzothiazole chloride |
|---|---|
| PubChem CID | 57371048 |
| Molecular Formula | C21H20ClN4O4S2- |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-6-nitro-2H-1,3-benzothiazol-2-yl)prop-2-enylidene]-6-nitro-1,3-benzothiazole chloride |
| SMILES | CCN1C(=CC=CC2Sc3cc([N+](=O)[O-])ccc3N2CC)Sc2cc([N+](=O)[O-])ccc21.[Cl-] |
| InChI | InChI=1S/C21H20N4O4S2.ClH/c1-3-22-16-10-8-14(24(26)27)12-18(16)30-20(22)6-5-7-21-23(4-2)17-11-9-15(25(28)29)13-19(17)31-21;/h5-13,20H,3-4H2,1-2H3;1H/p-1 |
| InChIKey | ITBAZJAJKQLSNM-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|