C21H16N4O5S — CID 151167630
3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]cyclobut-3-ene-1,2-dione (PubChem CID 151167630) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is 3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 151167630 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]cyclobut-3-ene-1,2-dione |
| SMILES | CCN1C(=Cc2c(NN=Cc3cc([N+](=O)[O-])ccc3O)c(=O)c2=O)Sc2ccccc21 |
| InChI | InChI=1S/C21H16N4O5S/c1-2-24-15-5-3-4-6-17(15)31-18(24)10-14-19(21(28)20(14)27)23-22-11-12-9-13(25(29)30)7-8-16(12)26/h3-11,23,26H,2H2,1H3 |
| InChIKey | NBPHMRNATBGVEA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|