C14H11N3O5 — CID 135775232
3-[(2Z)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 135775232) has the molecular formula C14H11N3O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 3-[(2Z)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 135775232 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-[(2Z)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1cccc(N/N=C\c2cc([N+](=O)[O-])ccc2O)c1 |
| InChI | InChI=1S/C14H11N3O5/c18-13-5-4-12(17(21)22)7-10(13)8-15-16-11-3-1-2-9(6-11)14(19)20/h1-8,16,18H,(H,19,20)/b15-8- |
| InChIKey | KSKNWVNJNHRWEW-NVNXTCNLSA-N |
| XLogP | 2.44 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|