C13H11N3O6S — CID 135625932
4-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzenesulfonic acid (PubChem CID 135625932) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is 4-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135625932 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/Nc2ccc(S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C13H11N3O6S/c17-13-6-3-11(16(18)19)7-9(13)8-14-15-10-1-4-12(5-2-10)23(20,21)22/h1-8,15,17H,(H,20,21,22)/b14-8+ |
| InChIKey | ZDKCFRVWYIVUNG-RIYZIHGNSA-N |
| XLogP | 1.99 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|