C19H16IN3O2S — CID 134124067
(2Z)-3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-nitro-1,3-benzothiazole iodide (PubChem CID 134124067) has the molecular formula C19H16IN3O2S and a molecular weight of 477.33 g/mol. Its IUPAC name is (2Z)-3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-nitro-1,3-benzothiazole iodide.
| Compound Name | (2Z)-3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-nitro-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 134124067 |
| Molecular Formula | C19H16IN3O2S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | (2Z)-3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-nitro-1,3-benzothiazole iodide |
| SMILES | CN1/C(=C/c2cc[n+](C)c3ccccc23)Sc2cc([N+](=O)[O-])ccc21.[I-] |
| InChI | InChI=1S/C19H16N3O2S.HI/c1-20-10-9-13(15-5-3-4-6-16(15)20)11-19-21(2)17-8-7-14(22(23)24)12-18(17)25-19;/h3-12H,1-2H3;1H/q+1;/p-1 |
| InChIKey | GNZVTIBMSMAMOP-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|