C28H27N4O2+ — CID 163215981
1-tert-butyl-9-methyl-3-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]-6-nitropyrido[3,4-b]indole (PubChem CID 163215981) has the molecular formula C28H27N4O2+ and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-tert-butyl-9-methyl-3-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]-6-nitropyrido[3,4-b]indole.
| Compound Name | 1-tert-butyl-9-methyl-3-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]-6-nitropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 163215981 |
| Molecular Formula | C28H27N4O2+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1-tert-butyl-9-methyl-3-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]-6-nitropyrido[3,4-b]indole |
| SMILES | Cn1c2ccc([N+](=O)[O-])cc2c2cc(/C=C/c3cc[n+](C)c4ccccc34)nc(C(C)(C)C)c21 |
| InChI | InChI=1S/C28H27N4O2/c1-28(2,3)27-26-23(22-17-20(32(33)34)12-13-25(22)31(26)5)16-19(29-27)11-10-18-14-15-30(4)24-9-7-6-8-21(18)24/h6-17H,1-5H3/q+1 |
| InChIKey | IMTMYKSITWZBEP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|