C24H20N3O3+ — CID 11548196
2,5,6-trimethyl-1-(4-nitrophenyl)pyrido[4,3-b]carbazol-2-ium-9-ol (PubChem CID 11548196) has the molecular formula C24H20N3O3+ and a molecular weight of 398.44 g/mol. Its IUPAC name is 2,5,6-trimethyl-1-(4-nitrophenyl)pyrido[4,3-b]carbazol-2-ium-9-ol.
| Compound Name | 2,5,6-trimethyl-1-(4-nitrophenyl)pyrido[4,3-b]carbazol-2-ium-9-ol |
|---|---|
| PubChem CID | 11548196 |
| Molecular Formula | C24H20N3O3+ |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2,5,6-trimethyl-1-(4-nitrophenyl)pyrido[4,3-b]carbazol-2-ium-9-ol |
| SMILES | Cc1c2cc[n+](C)c(-c3ccc([N+](=O)[O-])cc3)c2cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C24H19N3O3/c1-14-18-10-11-25(2)24(15-4-6-16(7-5-15)27(29)30)20(18)13-21-19-12-17(28)8-9-22(19)26(3)23(14)21/h4-13H,1-3H3/p+1 |
| InChIKey | GUGARKJBOAGACK-UHFFFAOYSA-O |
| XLogP | 4.90 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|