C26H25N2O2+ — CID 11519289
9-methoxy-1-(4-methoxyphenyl)-2,5,6-trimethylpyrido[4,3-b]carbazol-2-ium (PubChem CID 11519289) has the molecular formula C26H25N2O2+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 9-methoxy-1-(4-methoxyphenyl)-2,5,6-trimethylpyrido[4,3-b]carbazol-2-ium.
| Compound Name | 9-methoxy-1-(4-methoxyphenyl)-2,5,6-trimethylpyrido[4,3-b]carbazol-2-ium |
|---|---|
| PubChem CID | 11519289 |
| Molecular Formula | C26H25N2O2+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 9-methoxy-1-(4-methoxyphenyl)-2,5,6-trimethylpyrido[4,3-b]carbazol-2-ium |
| SMILES | COc1ccc(-c2c3cc4c5cc(OC)ccc5n(C)c4c(C)c3cc[n+]2C)cc1 |
| InChI | InChI=1S/C26H25N2O2/c1-16-20-12-13-27(2)26(17-6-8-18(29-4)9-7-17)22(20)15-23-21-14-19(30-5)10-11-24(21)28(3)25(16)23/h6-15H,1-5H3/q+1 |
| InChIKey | BKGYQSQFXAFIJG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|