C36H44Br2N4O2 — CID 127045953
7-methoxy-2-[8-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)octyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide (PubChem CID 127045953) has the molecular formula C36H44Br2N4O2 and a molecular weight of 724.58 g/mol. Its IUPAC name is 7-methoxy-2-[8-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)octyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 7-methoxy-2-[8-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)octyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 127045953 |
| Molecular Formula | C36H44Br2N4O2 |
| Molecular Weight | 724.58 g/mol |
| Exact Mass | 722.18 |
| IUPAC Name | 7-methoxy-2-[8-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)octyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide |
| SMILES | COc1ccc2c3cc[n+](CCCCCCCC[n+]4ccc5c6ccc(OC)cc6n(C)c5c4C)c(C)c3n(C)c2c1.[Br-].[Br-] |
| InChI | InChI=1S/C36H44N4O2.2BrH/c1-25-35-31(29-15-13-27(41-5)23-33(29)37(35)3)17-21-39(25)19-11-9-7-8-10-12-20-40-22-18-32-30-16-14-28(42-6)24-34(30)38(4)36(32)26(40)2;;/h13-18,21-24H,7-12,19-20H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | GBGOWLMTICQGOJ-UHFFFAOYSA-L |
| XLogP | 1.23 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|