C24H35N2O+ — CID 118733441
1-methyl-7-(3-methylbutoxy)-2-(2-methylpropyl)-9-propylpyrido[3,4-b]indol-2-ium (PubChem CID 118733441) has the molecular formula C24H35N2O+ and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-methyl-7-(3-methylbutoxy)-2-(2-methylpropyl)-9-propylpyrido[3,4-b]indol-2-ium.
| Compound Name | 1-methyl-7-(3-methylbutoxy)-2-(2-methylpropyl)-9-propylpyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 118733441 |
| Molecular Formula | C24H35N2O+ |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 1-methyl-7-(3-methylbutoxy)-2-(2-methylpropyl)-9-propylpyrido[3,4-b]indol-2-ium |
| SMILES | CCCn1c2cc(OCCC(C)C)ccc2c2cc[n+](CC(C)C)c(C)c21 |
| InChI | InChI=1S/C24H35N2O/c1-7-12-26-23-15-20(27-14-11-17(2)3)8-9-21(23)22-10-13-25(16-18(4)5)19(6)24(22)26/h8-10,13,15,17-18H,7,11-12,14,16H2,1-6H3/q+1 |
| InChIKey | YPMWLVCHXMSCDN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|