C27H33N2O+ — CID 71575372
2-benzyl-9-butyl-1-methyl-7-(2-methylpropoxy)pyrido[3,4-b]indol-2-ium (PubChem CID 71575372) has the molecular formula C27H33N2O+ and a molecular weight of 401.57 g/mol. Its IUPAC name is 2-benzyl-9-butyl-1-methyl-7-(2-methylpropoxy)pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-benzyl-9-butyl-1-methyl-7-(2-methylpropoxy)pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 71575372 |
| Molecular Formula | C27H33N2O+ |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 2-benzyl-9-butyl-1-methyl-7-(2-methylpropoxy)pyrido[3,4-b]indol-2-ium |
| SMILES | CCCCn1c2cc(OCC(C)C)ccc2c2cc[n+](Cc3ccccc3)c(C)c21 |
| InChI | InChI=1S/C27H33N2O/c1-5-6-15-29-26-17-23(30-19-20(2)3)12-13-24(26)25-14-16-28(21(4)27(25)29)18-22-10-8-7-9-11-22/h7-14,16-17,20H,5-6,15,18-19H2,1-4H3/q+1 |
| InChIKey | RIUBAERVSGXLJN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|