About 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide
2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide (PubChem CID 71739928) has the molecular formula C28H27BrN2
and a molecular weight of 471.44 g/mol. Its IUPAC name is 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide.
Molecular Properties
| Compound Name | 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide |
| PubChem CID | 71739928 |
| Molecular Formula | C28H27BrN2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide |
| SMILES | Cc1c2c(cc[n+]1Cc1ccccc1)c1ccccc1n2CCCc1ccccc1.[Br-] |
| InChI | InChI=1S/C28H27N2.BrH/c1-22-28-26(18-20-29(22)21-24-13-6-3-7-14-24)25-16-8-9-17-27(25)30(28)19-10-15-23-11-4-2-5-12-23;/h2-9,11-14,16-18,20H,10,15,19,21H2,1H3;1H/q+1;/p-1 |
| InChIKey | AFESUHGQJMNTIZ-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide?
The IUPAC name of 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide (CID 71739928) is 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide.
What is the SMILES notation for 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide?
The canonical SMILES for 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide is Cc1c2c(cc[n+]1Cc1ccccc1)c1ccccc1n2CCCc1ccccc1.[Br-].
What is the InChIKey of 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide?
The InChIKey is AFESUHGQJMNTIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H27N2.BrH/c1-22-28-26(18-20-29(22)21-24-13-6-3-7-14-24)25-16-8-9-17-27(25)30(28)19-10-15-23-11-4-2-5-12-23;/h2-9,11-14,16-18,20H,10,15,19,21H2,1H3;1H/q+1;/p-1.
What are the key properties of 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide?
2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide has a molecular weight of 471.44 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide is sourced from PubChem (CID 71739928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).