C33H28BrFN2O — CID 54766731
9-benzyl-2-[(4-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide (PubChem CID 54766731) has the molecular formula C33H28BrFN2O and a molecular weight of 567.50 g/mol. Its IUPAC name is 9-benzyl-2-[(4-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 9-benzyl-2-[(4-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 54766731 |
| Molecular Formula | C33H28BrFN2O |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 9-benzyl-2-[(4-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
| SMILES | Cc1c2c(cc[n+]1Cc1ccc(F)cc1)c1ccc(OCc3ccccc3)cc1n2Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C33H28FN2O.BrH/c1-24-33-31(18-19-35(24)21-26-12-14-28(34)15-13-26)30-17-16-29(37-23-27-10-6-3-7-11-27)20-32(30)36(33)22-25-8-4-2-5-9-25;/h2-20H,21-23H2,1H3;1H/q+1;/p-1 |
| InChIKey | HDGXFFZEDXJLJV-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|