C24H28Cl2N4O4 — CID 22117406
[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium-9-yl] acetate;dihydrochloride (PubChem CID 22117406) has the molecular formula C24H28Cl2N4O4 and a molecular weight of 507.42 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium-9-yl] acetate;dihydrochloride.
| Compound Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium-9-yl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 22117406 |
| Molecular Formula | C24H28Cl2N4O4 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium-9-yl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccc2c(c1)c1cc3c(C(=O)NCCN(C)C)[n+]([O-])ccc3c(C)c1n2C.Cl.Cl |
| InChI | InChI=1S/C24H26N4O4.2ClH/c1-14-17-8-10-28(31)23(24(30)25-9-11-26(3)4)19(17)13-20-18-12-16(32-15(2)29)6-7-21(18)27(5)22(14)20;;/h6-8,10,12-13H,9,11H2,1-5H3,(H,25,30);2*1H |
| InChIKey | GGGDMQUKZXGATK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|