C20H20N2O4 — CID 71415857
[7-(diacetylamino)-8,9-dimethylcarbazol-3-yl] acetate (PubChem CID 71415857) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [7-(diacetylamino)-8,9-dimethylcarbazol-3-yl] acetate.
| Compound Name | [7-(diacetylamino)-8,9-dimethylcarbazol-3-yl] acetate |
|---|---|
| PubChem CID | 71415857 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [7-(diacetylamino)-8,9-dimethylcarbazol-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)c1ccc(N(C(C)=O)C(C)=O)c(C)c1n2C |
| InChI | InChI=1S/C20H20N2O4/c1-11-18(22(12(2)23)13(3)24)9-7-16-17-10-15(26-14(4)25)6-8-19(17)21(5)20(11)16/h6-10H,1-5H3 |
| InChIKey | JIAJFXMKZHEFJZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|