C22H25N5O2 — CID 70151143
N'-[2-(dimethylamino)ethyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carbohydrazide (PubChem CID 70151143) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carbohydrazide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carbohydrazide |
|---|---|
| PubChem CID | 70151143 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carbohydrazide |
| SMILES | Cc1c2ccnc(C(=O)NNCCN(C)C)c2cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C22H25N5O2/c1-13-15-7-8-23-20(22(29)25-24-9-10-26(2)3)17(15)12-18-16-11-14(28)5-6-19(16)27(4)21(13)18/h5-8,11-12,24,28H,9-10H2,1-4H3,(H,25,29) |
| InChIKey | KPZRGXAZVSXNGV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|