C13H12ClNO3 — CID 86672895
(3-carbonochloridoyl-1,2-dimethylindol-5-yl) acetate (PubChem CID 86672895) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is (3-carbonochloridoyl-1,2-dimethylindol-5-yl) acetate.
| Compound Name | (3-carbonochloridoyl-1,2-dimethylindol-5-yl) acetate |
|---|---|
| PubChem CID | 86672895 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (3-carbonochloridoyl-1,2-dimethylindol-5-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)c(C(=O)Cl)c(C)n2C |
| InChI | InChI=1S/C13H12ClNO3/c1-7-12(13(14)17)10-6-9(18-8(2)16)4-5-11(10)15(7)3/h4-6H,1-3H3 |
| InChIKey | ZLDJXVKCWFVWNM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|