C19H13NO4 — CID 10615565
(5-methyl-6,11-dioxobenzo[b]carbazol-2-yl) acetate (PubChem CID 10615565) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (5-methyl-6,11-dioxobenzo[b]carbazol-2-yl) acetate.
| Compound Name | (5-methyl-6,11-dioxobenzo[b]carbazol-2-yl) acetate |
|---|---|
| PubChem CID | 10615565 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (5-methyl-6,11-dioxobenzo[b]carbazol-2-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)c1c(n2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13NO4/c1-10(21)24-11-7-8-15-14(9-11)16-17(20(15)2)19(23)13-6-4-3-5-12(13)18(16)22/h3-9H,1-2H3 |
| InChIKey | LZNZDBDMSAJXRH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|