C20H12O7 — CID 21325759
(5,7,12-trihydroxy-6,11-dioxotetracen-2-yl) acetate (PubChem CID 21325759) has the molecular formula C20H12O7 and a molecular weight of 364.31 g/mol. Its IUPAC name is (5,7,12-trihydroxy-6,11-dioxotetracen-2-yl) acetate.
| Compound Name | (5,7,12-trihydroxy-6,11-dioxotetracen-2-yl) acetate |
|---|---|
| PubChem CID | 21325759 |
| Molecular Formula | C20H12O7 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (5,7,12-trihydroxy-6,11-dioxotetracen-2-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(O)c3c(c(O)c2c1)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C20H12O7/c1-8(21)27-9-5-6-10-12(7-9)19(25)15-16(17(10)23)20(26)14-11(18(15)24)3-2-4-13(14)22/h2-7,22-23,25H,1H3 |
| InChIKey | SFKBZZVABPEDNM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|