C20H12O7 — CID 155290613
methyl 5,7,12-trihydroxy-6,11-dioxotetracene-2-carboxylate (PubChem CID 155290613) has the molecular formula C20H12O7 and a molecular weight of 364.31 g/mol. Its IUPAC name is methyl 5,7,12-trihydroxy-6,11-dioxotetracene-2-carboxylate.
| Compound Name | methyl 5,7,12-trihydroxy-6,11-dioxotetracene-2-carboxylate |
|---|---|
| PubChem CID | 155290613 |
| Molecular Formula | C20H12O7 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | methyl 5,7,12-trihydroxy-6,11-dioxotetracene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(O)c3c(c(O)c2c1)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C20H12O7/c1-27-20(26)8-5-6-9-11(7-8)18(24)14-15(16(9)22)19(25)13-10(17(14)23)3-2-4-12(13)21/h2-7,21-22,24H,1H3 |
| InChIKey | VQRYGLOAHKMDHB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|